C18H16N2O2 — CID 563298
6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one (PubChem CID 563298) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one.
| Compound Name | 6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 563298 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES | O=C1NCCc2c1[nH]c1ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C18H16N2O2/c21-18-17-14(8-9-19-18)15-10-13(6-7-16(15)20-17)22-11-12-4-2-1-3-5-12/h1-7,10,20H,8-9,11H2,(H,19,21) |
| InChIKey | GFULUZWYBKHEKQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|