C12H10F7N — CID 563360
2,2,3,3,4,4,4-heptafluoro-N-(2-phenylethyl)butan-1-imine (PubChem CID 563360) has the molecular formula C12H10F7N and a molecular weight of 301.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-phenylethyl)butan-1-imine.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-phenylethyl)butan-1-imine |
|---|---|
| PubChem CID | 563360 |
| Molecular Formula | C12H10F7N |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-phenylethyl)butan-1-imine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)/C=N/CCc1ccccc1 |
| InChI | InChI=1S/C12H10F7N/c13-10(14,11(15,16)12(17,18)19)8-20-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2/b20-8+ |
| InChIKey | ZMEUDXSOKSBVSN-DNTJNYDQSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|