C10H6N4O2 — CID 563387
3,5-dioxo-2-phenyl-1,2,4-triazine-6-carbonitrile (PubChem CID 563387) has the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3,5-dioxo-2-phenyl-1,2,4-triazine-6-carbonitrile.
| Compound Name | 3,5-dioxo-2-phenyl-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 563387 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3,5-dioxo-2-phenyl-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H6N4O2/c11-6-8-9(15)12-10(16)14(13-8)7-4-2-1-3-5-7/h1-5H,(H,12,15,16) |
| InChIKey | ROQHNTYEGUCQQA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |