C19H19N3O2 — CID 563391
N-benzyl-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 563391) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-benzyl-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-benzyl-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 563391 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-benzyl-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | O=[N+]([O-])c1ccc2[nH]c3c(c2c1)CCCC3NCc1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c23-22(24)14-9-10-17-16(11-14)15-7-4-8-18(19(15)21-17)20-12-13-5-2-1-3-6-13/h1-3,5-6,9-11,18,20-21H,4,7-8,12H2 |
| InChIKey | ZBKRFVVVGSFJGF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|