C11H7F6NO4 — CID 563410
(2-methyl-N-(2,2,2-trifluoroacetyl)oxyanilino) 2,2,2-trifluoroacetate (PubChem CID 563410) has the molecular formula C11H7F6NO4 and a molecular weight of 331.17 g/mol. Its IUPAC name is (2-methyl-N-(2,2,2-trifluoroacetyl)oxyanilino) 2,2,2-trifluoroacetate.
| Compound Name | (2-methyl-N-(2,2,2-trifluoroacetyl)oxyanilino) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 563410 |
| Molecular Formula | C11H7F6NO4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (2-methyl-N-(2,2,2-trifluoroacetyl)oxyanilino) 2,2,2-trifluoroacetate |
| SMILES | Cc1ccccc1N(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H7F6NO4/c1-6-4-2-3-5-7(6)18(21-8(19)10(12,13)14)22-9(20)11(15,16)17/h2-5H,1H3 |
| InChIKey | BVEWUFMNUJPLCU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|