C37H30N8+2 — CID 563508
3-methyl-2-[(3-methyl-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium (PubChem CID 563508) has the molecular formula C37H30N8+2 and a molecular weight of 586.70 g/mol. Its IUPAC name is 3-methyl-2-[(3-methyl-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium.
| Compound Name | 3-methyl-2-[(3-methyl-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium |
|---|---|
| PubChem CID | 563508 |
| Molecular Formula | C37H30N8+2 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 3-methyl-2-[(3-methyl-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-diphenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium |
| SMILES | C[n+]1c(Cc2nn3c(-c4ccccc4)cc(-c4ccccc4)nc3[n+]2C)nn2c(-c3ccccc3)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C37H30N8/c1-42-34(40-44-32(28-19-11-5-12-20-28)23-30(38-36(42)44)26-15-7-3-8-16-26)25-35-41-45-33(29-21-13-6-14-22-29)24-31(39-37(45)43(35)2)27-17-9-4-10-18-27/h3-24H,25H2,1-2H3/q+2 |
| InChIKey | RZCBCRDPPPSKDQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 68.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|