About benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 563688) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 563688 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCc1c(C)[nH]c(C(=O)OCc2ccccc2)c1C |
| InChI | InChI=1S/C16H19NO2/c1-4-14-11(2)15(17-12(14)3)16(18)19-10-13-8-6-5-7-9-13/h5-9,17H,4,10H2,1-3H3 |
| InChIKey | HQVVEVXUDZVUAX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CID 563688) is benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is CCc1c(C)[nH]c(C(=O)OCc2ccccc2)c1C.
What is the InChIKey of benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The InChIKey is HQVVEVXUDZVUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-4-14-11(2)15(17-12(14)3)16(18)19-10-13-8-6-5-7-9-13/h5-9,17H,4,10H2,1-3H3.
What are the key properties of benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate has a molecular weight of 257.33 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 563688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).