C20H27F3N2O6 — CID 563800
2,2,2-trifluoroethyl 4-(benzylamino)-5-[[2-(2-ethoxyethoxy)-2-oxoethyl]amino]-5-oxopentanoate (PubChem CID 563800) has the molecular formula C20H27F3N2O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(benzylamino)-5-[[2-(2-ethoxyethoxy)-2-oxoethyl]amino]-5-oxopentanoate.
| Compound Name | 2,2,2-trifluoroethyl 4-(benzylamino)-5-[[2-(2-ethoxyethoxy)-2-oxoethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 563800 |
| Molecular Formula | C20H27F3N2O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(benzylamino)-5-[[2-(2-ethoxyethoxy)-2-oxoethyl]amino]-5-oxopentanoate |
| SMILES | CCOCCOC(=O)CNC(=O)C(CCC(=O)OCC(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C20H27F3N2O6/c1-2-29-10-11-30-18(27)13-25-19(28)16(24-12-15-6-4-3-5-7-15)8-9-17(26)31-14-20(21,22)23/h3-7,16,24H,2,8-14H2,1H3,(H,25,28) |
| InChIKey | VCUOAIPLNDGPHY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|