C18H20O3 — CID 563840
2-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-dioxolane (PubChem CID 563840) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 563840 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-dioxolane |
| SMILES | c1ccc(COc2ccc(CCC3OCCO3)cc2)cc1 |
| InChI | InChI=1S/C18H20O3/c1-2-4-16(5-3-1)14-21-17-9-6-15(7-10-17)8-11-18-19-12-13-20-18/h1-7,9-10,18H,8,11-14H2 |
| InChIKey | STGUTQYRXWNJPC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |