C28H32N2O4 — CID 563903
ethyl 4-(dibenzylamino)-2-formamido-3-hydroxy-5-phenylpentanoate (PubChem CID 563903) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl 4-(dibenzylamino)-2-formamido-3-hydroxy-5-phenylpentanoate.
| Compound Name | ethyl 4-(dibenzylamino)-2-formamido-3-hydroxy-5-phenylpentanoate |
|---|---|
| PubChem CID | 563903 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | ethyl 4-(dibenzylamino)-2-formamido-3-hydroxy-5-phenylpentanoate |
| SMILES | CCOC(=O)C(NC=O)C(O)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c1-2-34-28(33)26(29-21-31)27(32)25(18-22-12-6-3-7-13-22)30(19-23-14-8-4-9-15-23)20-24-16-10-5-11-17-24/h3-17,21,25-27,32H,2,18-20H2,1H3,(H,29,31) |
| InChIKey | YKTNSLAPBKACLK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|