C11H8F7NO — CID 563921
N-benzyl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 563921) has the molecular formula C11H8F7NO and a molecular weight of 303.18 g/mol. Its IUPAC name is N-benzyl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-benzyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 563921 |
| Molecular Formula | C11H8F7NO |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-benzyl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F7NO/c12-9(13,10(14,15)11(16,17)18)8(20)19-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,19,20) |
| InChIKey | JGYHLDPCXQPJCA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|