C18H18F2O2 — CID 563928
5,7-difluoro-4,4-dimethyl-6-phenylmethoxy-2,3-dihydrochromene (PubChem CID 563928) has the molecular formula C18H18F2O2 and a molecular weight of 304.34 g/mol. Its IUPAC name is 5,7-difluoro-4,4-dimethyl-6-phenylmethoxy-2,3-dihydrochromene.
| Compound Name | 5,7-difluoro-4,4-dimethyl-6-phenylmethoxy-2,3-dihydrochromene |
|---|---|
| PubChem CID | 563928 |
| Molecular Formula | C18H18F2O2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5,7-difluoro-4,4-dimethyl-6-phenylmethoxy-2,3-dihydrochromene |
| SMILES | CC1(C)CCOc2cc(F)c(OCc3ccccc3)c(F)c21 |
| InChI | InChI=1S/C18H18F2O2/c1-18(2)8-9-21-14-10-13(19)17(16(20)15(14)18)22-11-12-6-4-3-5-7-12/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | ILBPRAUYVQVISK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |