C16H12BrF6N3O — CID 564074
N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide (PubChem CID 564074) has the molecular formula C16H12BrF6N3O and a molecular weight of 456.18 g/mol. Its IUPAC name is N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide.
| Compound Name | N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 564074 |
| Molecular Formula | C16H12BrF6N3O |
| Molecular Weight | 456.18 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(Nc1ccc(Br)cn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H12BrF6N3O/c17-11-6-7-12(24-9-11)25-14(15(18,19)20,16(21,22)23)26-13(27)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,24,25)(H,26,27) |
| InChIKey | JMKHUEOLLPPMAZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|