About trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane
trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane (PubChem CID 564252) has the molecular formula C15H26Si2
and a molecular weight of 262.54 g/mol. Its IUPAC name is trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane.
Molecular Properties
| Compound Name | trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane |
| PubChem CID | 564252 |
| Molecular Formula | C15H26Si2 |
| Molecular Weight | 262.54 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)C2C=CC=CC1C2 |
| InChI | InChI=1S/C15H26Si2/c1-16(2,3)14-12-9-7-8-10-13(11-12)15(14)17(4,5)6/h7-10,12-13H,11H2,1-6H3 |
| InChIKey | DSWXHMBQABMRSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane?
The IUPAC name of trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane (CID 564252) is trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane.
What is the SMILES notation for trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane?
The canonical SMILES for trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane is C[Si](C)(C)C1=C([Si](C)(C)C)C2C=CC=CC1C2.
What is the InChIKey of trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane?
The InChIKey is DSWXHMBQABMRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26Si2/c1-16(2,3)14-12-9-7-8-10-13(11-12)15(14)17(4,5)6/h7-10,12-13H,11H2,1-6H3.
What are the key properties of trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane?
trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane has a molecular weight of 262.54 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(8-trimethylsilyl-7-bicyclo[4.2.1]nona-2,4,7-trienyl)silane is sourced from PubChem (CID 564252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).