About 5-methylheptylbenzene
5-methylheptylbenzene (PubChem CID 564254) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 5-methylheptylbenzene.
Molecular Properties
| Compound Name | 5-methylheptylbenzene |
| PubChem CID | 564254 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 5-methylheptylbenzene |
| SMILES | CCC(C)CCCCc1ccccc1 |
| InChI | InChI=1S/C14H22/c1-3-13(2)9-7-8-12-14-10-5-4-6-11-14/h4-6,10-11,13H,3,7-9,12H2,1-2H3 |
| InChIKey | UPVOVYXEOKLFQE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methylheptylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylheptylbenzene?
The IUPAC name of 5-methylheptylbenzene (CID 564254) is 5-methylheptylbenzene.
What is the SMILES notation for 5-methylheptylbenzene?
The canonical SMILES for 5-methylheptylbenzene is CCC(C)CCCCc1ccccc1.
What is the InChIKey of 5-methylheptylbenzene?
The InChIKey is UPVOVYXEOKLFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-3-13(2)9-7-8-12-14-10-5-4-6-11-14/h4-6,10-11,13H,3,7-9,12H2,1-2H3.
What are the key properties of 5-methylheptylbenzene?
5-methylheptylbenzene has a molecular weight of 190.33 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylheptylbenzene is sourced from PubChem (CID 564254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).