C12H18 — CID 564276
4a,5,6,7,8,9,10,10a-octahydrobenzo[8]annulene (PubChem CID 564276) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 4a,5,6,7,8,9,10,10a-octahydrobenzo[8]annulene.
| Compound Name | 4a,5,6,7,8,9,10,10a-octahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 564276 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 4a,5,6,7,8,9,10,10a-octahydrobenzo[8]annulene |
| SMILES | C1=CC2CCCCCCC2C=C1 |
| InChI | InChI=1S/C12H18/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h5-6,9-12H,1-4,7-8H2 |
| InChIKey | AQOJTWHIRUNPSZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |