C14H22 — CID 564371
12-methyltrideca-1,5,9,11-tetraene (PubChem CID 564371) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 12-methyltrideca-1,5,9,11-tetraene.
| Compound Name | 12-methyltrideca-1,5,9,11-tetraene |
|---|---|
| PubChem CID | 564371 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 12-methyltrideca-1,5,9,11-tetraene |
| SMILES | C=CCCC=CCCC=CC=C(C)C |
| InChI | InChI=1S/C14H22/c1-4-5-6-7-8-9-10-11-12-13-14(2)3/h4,7-8,11-13H,1,5-6,9-10H2,2-3H3 |
| InChIKey | JSNIXUNQFVQSSK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|