C12H18O — CID 564529
4-propan-2-yl-1,3,3a,4,7,7a-hexahydroinden-2-one (PubChem CID 564529) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-propan-2-yl-1,3,3a,4,7,7a-hexahydroinden-2-one.
| Compound Name | 4-propan-2-yl-1,3,3a,4,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 564529 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-propan-2-yl-1,3,3a,4,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)C1C=CCC2CC(=O)CC21 |
| InChI | InChI=1S/C12H18O/c1-8(2)11-5-3-4-9-6-10(13)7-12(9)11/h3,5,8-9,11-12H,4,6-7H2,1-2H3 |
| InChIKey | MNCSLWSQTFQICJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|