About 4-ethylnon-3-en-5-yne
4-ethylnon-3-en-5-yne (PubChem CID 564545) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is 4-ethylnon-3-en-5-yne.
Molecular Properties
| Compound Name | 4-ethylnon-3-en-5-yne |
| PubChem CID | 564545 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 4-ethylnon-3-en-5-yne |
| SMILES | CCC=C(C#CCCC)CC |
| InChI | InChI=1S/C11H18/c1-4-7-8-10-11(6-3)9-5-2/h9H,4-7H2,1-3H3 |
| InChIKey | WINAGOYHXUXSTM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylnon-3-en-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylnon-3-en-5-yne?
The IUPAC name of 4-ethylnon-3-en-5-yne (CID 564545) is 4-ethylnon-3-en-5-yne.
What is the SMILES notation for 4-ethylnon-3-en-5-yne?
The canonical SMILES for 4-ethylnon-3-en-5-yne is CCC=C(C#CCCC)CC.
What is the InChIKey of 4-ethylnon-3-en-5-yne?
The InChIKey is WINAGOYHXUXSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-4-7-8-10-11(6-3)9-5-2/h9H,4-7H2,1-3H3.
What are the key properties of 4-ethylnon-3-en-5-yne?
4-ethylnon-3-en-5-yne has a molecular weight of 150.26 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylnon-3-en-5-yne is sourced from PubChem (CID 564545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).