About 3,7-dimethylocta-1,6-dien-3-yl hexanoate
3,7-dimethylocta-1,6-dien-3-yl hexanoate (PubChem CID 564550) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl hexanoate.
Molecular Properties
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl hexanoate |
| PubChem CID | 564550 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl hexanoate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C16H28O2/c1-6-8-9-12-15(17)18-16(5,7-2)13-10-11-14(3)4/h7,11H,2,6,8-10,12-13H2,1,3-5H3 |
| InChIKey | ALKCLFLTXBBMMP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-1,6-dien-3-yl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-1,6-dien-3-yl hexanoate?
The IUPAC name of 3,7-dimethylocta-1,6-dien-3-yl hexanoate (CID 564550) is 3,7-dimethylocta-1,6-dien-3-yl hexanoate.
What is the SMILES notation for 3,7-dimethylocta-1,6-dien-3-yl hexanoate?
The canonical SMILES for 3,7-dimethylocta-1,6-dien-3-yl hexanoate is C=CC(C)(CCC=C(C)C)OC(=O)CCCCC.
What is the InChIKey of 3,7-dimethylocta-1,6-dien-3-yl hexanoate?
The InChIKey is ALKCLFLTXBBMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-6-8-9-12-15(17)18-16(5,7-2)13-10-11-14(3)4/h7,11H,2,6,8-10,12-13H2,1,3-5H3.
What are the key properties of 3,7-dimethylocta-1,6-dien-3-yl hexanoate?
3,7-dimethylocta-1,6-dien-3-yl hexanoate has a molecular weight of 252.40 g/mol, XLogP of 4.80, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-1,6-dien-3-yl hexanoate is sourced from PubChem (CID 564550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).