C14H21NO — CID 564564
7,7,11-trimethyl-6-azatricyclo[6.3.1.02,6]dodec-10-en-5-one (PubChem CID 564564) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 7,7,11-trimethyl-6-azatricyclo[6.3.1.02,6]dodec-10-en-5-one.
| Compound Name | 7,7,11-trimethyl-6-azatricyclo[6.3.1.02,6]dodec-10-en-5-one |
|---|---|
| PubChem CID | 564564 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 7,7,11-trimethyl-6-azatricyclo[6.3.1.02,6]dodec-10-en-5-one |
| SMILES | CC1=CCC2CC1C1CCC(=O)N1C2(C)C |
| InChI | InChI=1S/C14H21NO/c1-9-4-5-10-8-11(9)12-6-7-13(16)15(12)14(10,2)3/h4,10-12H,5-8H2,1-3H3 |
| InChIKey | JZGSLCSRPGXURP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|