C12H18O2 — CID 564606
5-ethylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxolane] (PubChem CID 564606) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 5-ethylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxolane].
| Compound Name | 5-ethylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 564606 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5-ethylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxolane] |
| SMILES | CC=C1CC2CC3(CC2C1)OCCO3 |
| InChI | InChI=1S/C12H18O2/c1-2-9-5-10-7-12(8-11(10)6-9)13-3-4-14-12/h2,10-11H,3-8H2,1H3 |
| InChIKey | NDELZHCTACLRLG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|