About N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine
N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine (PubChem CID 564702) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine.
Molecular Properties
| Compound Name | N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine |
| PubChem CID | 564702 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine |
| SMILES | c1ccc(NC2=NC3C4CCC(C4)C3CO2)cc1 |
| InChI | InChI=1S/C15H18N2O/c1-2-4-12(5-3-1)16-15-17-14-11-7-6-10(8-11)13(14)9-18-15/h1-5,10-11,13-14H,6-9H2,(H,16,17) |
| InChIKey | XUPFAIKUGCPIHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine?
The IUPAC name of N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine (CID 564702) is N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine.
What is the SMILES notation for N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine?
The canonical SMILES for N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine is c1ccc(NC2=NC3C4CCC(C4)C3CO2)cc1.
What is the InChIKey of N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine?
The InChIKey is XUPFAIKUGCPIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-2-4-12(5-3-1)16-15-17-14-11-7-6-10(8-11)13(14)9-18-15/h1-5,10-11,13-14H,6-9H2,(H,16,17).
What are the key properties of N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine?
N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine has a molecular weight of 242.32 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-5-oxa-3-azatricyclo[6.2.1.02,7]undec-3-en-4-amine is sourced from PubChem (CID 564702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).