About N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide
N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 564741) has the molecular formula C11H10N4O2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide |
| PubChem CID | 564741 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(NCc1ccncc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C11H10N4O2S/c16-9(10(17)15-11-13-5-6-18-11)14-7-8-1-3-12-4-2-8/h1-6H,7H2,(H,14,16)(H,13,15,17) |
| InChIKey | BMVXVZDZCUPPEF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide?
The IUPAC name of N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide (CID 564741) is N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide is O=C(NCc1ccncc1)C(=O)Nc1nccs1.
What is the InChIKey of N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide?
The InChIKey is BMVXVZDZCUPPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2S/c16-9(10(17)15-11-13-5-6-18-11)14-7-8-1-3-12-4-2-8/h1-6H,7H2,(H,14,16)(H,13,15,17).
What are the key properties of N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide?
N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide has a molecular weight of 262.29 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-4-ylmethyl)-N'-(1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 564741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).