About 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one
7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one (PubChem CID 564829) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one.
Molecular Properties
| Compound Name | 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one |
| PubChem CID | 564829 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one |
| SMILES | C=C1CCC2CC1C1CCC(=O)N1C2(C)C |
| InChI | InChI=1S/C14H21NO/c1-9-4-5-10-8-11(9)12-6-7-13(16)15(12)14(10,2)3/h10-12H,1,4-8H2,2-3H3 |
| InChIKey | QQBMPNKHXHUAEF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one?
The IUPAC name of 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one (CID 564829) is 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one.
What is the SMILES notation for 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one?
The canonical SMILES for 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one is C=C1CCC2CC1C1CCC(=O)N1C2(C)C.
What is the InChIKey of 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one?
The InChIKey is QQBMPNKHXHUAEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-9-4-5-10-8-11(9)12-6-7-13(16)15(12)14(10,2)3/h10-12H,1,4-8H2,2-3H3.
What are the key properties of 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one?
7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one has a molecular weight of 219.33 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-11-methylidene-6-azatricyclo[6.3.1.02,6]dodecan-5-one is sourced from PubChem (CID 564829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).