About 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one
1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one (PubChem CID 564831) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 564831 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C8H8N4O3/c1-10-5-3-4-6(12(14)15)9-7(5)11(2)8(10)13/h3-4H,1-2H3 |
| InChIKey | JSMOQPGLEWVDLR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one (CID 564831) is 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one is Cn1c(=O)n(C)c2nc([N+](=O)[O-])ccc21.
What is the InChIKey of 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The InChIKey is JSMOQPGLEWVDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c1-10-5-3-4-6(12(14)15)9-7(5)11(2)8(10)13/h3-4H,1-2H3.
What are the key properties of 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one has a molecular weight of 208.18 g/mol, XLogP of 0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 564831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).