C11H12O4 — CID 565011
1,7-dimethyl-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione (PubChem CID 565011) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1,7-dimethyl-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione.
| Compound Name | 1,7-dimethyl-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 565011 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1,7-dimethyl-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione |
| SMILES | CC12CC(=O)C(C)(C1)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C11H12O4/c1-10-3-5(12)11(2,4-10)7-6(10)8(13)15-9(7)14/h6-7H,3-4H2,1-2H3 |
| InChIKey | XEFBIROGGHJNSR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|