C11H16 — CID 565023
4a-methyl-2,5,8,8a-tetrahydro-1H-naphthalene (PubChem CID 565023) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 4a-methyl-2,5,8,8a-tetrahydro-1H-naphthalene.
| Compound Name | 4a-methyl-2,5,8,8a-tetrahydro-1H-naphthalene |
|---|---|
| PubChem CID | 565023 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 4a-methyl-2,5,8,8a-tetrahydro-1H-naphthalene |
| SMILES | CC12C=CCCC1CC=CC2 |
| InChI | InChI=1S/C11H16/c1-11-8-4-2-6-10(11)7-3-5-9-11/h2,4-5,9-10H,3,6-8H2,1H3 |
| InChIKey | NLRFUYAHCNZJLW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|