C21H26FN3O — CID 56503227
2-(2-ethyl-6-methylanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 56503227) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-(2-ethyl-6-methylanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-ethyl-6-methylanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 56503227 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-(2-ethyl-6-methylanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CCc1cccc(C)c1NCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H26FN3O/c1-3-17-6-4-5-16(2)21(17)23-15-20(26)25-13-11-24(12-14-25)19-9-7-18(22)8-10-19/h4-10,23H,3,11-15H2,1-2H3 |
| InChIKey | ASUAAGKGRMANOS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |