C18H25N5O3 — CID 56504264
N'-[2-(4-methylanilino)acetyl]-4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide (PubChem CID 56504264) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N'-[2-(4-methylanilino)acetyl]-4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide.
| Compound Name | N'-[2-(4-methylanilino)acetyl]-4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide |
|---|---|
| PubChem CID | 56504264 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N'-[2-(4-methylanilino)acetyl]-4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCCc2nc(C(C)C)no2)cc1 |
| InChI | InChI=1S/C18H25N5O3/c1-12(2)18-20-17(26-23-18)6-4-5-15(24)21-22-16(25)11-19-14-9-7-13(3)8-10-14/h7-10,12,19H,4-6,11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | JLGZWXPSPZKKEA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|