About N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide
N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide (PubChem CID 56505801) has the molecular formula C30H27N3O3
and a molecular weight of 477.56 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide.
Molecular Properties
| Compound Name | N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide |
| PubChem CID | 56505801 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NC(c1ccccc1)c1c(O)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O3/c31-20-9-21-33(24-13-5-2-6-14-24)28(36)19-18-27(35)32-30(23-11-3-1-4-12-23)29-25-15-8-7-10-22(25)16-17-26(29)34/h1-8,10-17,30,34H,9,18-19,21H2,(H,32,35) |
| InChIKey | RSORVTPEAJJYQH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide?
The IUPAC name of N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide (CID 56505801) is N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide.
What is the SMILES notation for N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide?
The canonical SMILES for N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide is N#CCCN(C(=O)CCC(=O)NC(c1ccccc1)c1c(O)ccc2ccccc12)c1ccccc1.
What is the InChIKey of N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide?
The InChIKey is RSORVTPEAJJYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27N3O3/c31-20-9-21-33(24-13-5-2-6-14-24)28(36)19-18-27(35)32-30(23-11-3-1-4-12-23)29-25-15-8-7-10-22(25)16-17-26(29)34/h1-8,10-17,30,34H,9,18-19,21H2,(H,32,35).
What are the key properties of N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide?
N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide has a molecular weight of 477.56 g/mol, XLogP of 5.48, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanoethyl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-N'-phenylbutanediamide is sourced from PubChem (CID 56505801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).