C22H20N6O3 — CID 56506638
1-[4-[[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]amino]phenyl]pyrazole-3-carboxamide (PubChem CID 56506638) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-[4-[[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]amino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-[[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]amino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56506638 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[4-[[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]amino]phenyl]pyrazole-3-carboxamide |
| SMILES | Cn1ccnc1COc1ccc(C(=O)Nc2ccc(-n3ccc(C(N)=O)n3)cc2)cc1 |
| InChI | InChI=1S/C22H20N6O3/c1-27-13-11-24-20(27)14-31-18-8-2-15(3-9-18)22(30)25-16-4-6-17(7-5-16)28-12-10-19(26-28)21(23)29/h2-13H,14H2,1H3,(H2,23,29)(H,25,30) |
| InChIKey | JIHUDHJEPSQVTO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |