C23H17ClN2O3S — CID 56506682
2-[(3-chlorophenyl)methylsulfanyl]-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide (PubChem CID 56506682) has the molecular formula C23H17ClN2O3S and a molecular weight of 436.92 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 56506682 |
| Molecular Formula | C23H17ClN2O3S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide |
| SMILES | O=C(CSCc1cccc(Cl)c1)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H17ClN2O3S/c24-16-6-3-5-15(11-16)13-30-14-21(27)25-17-7-4-8-18(12-17)26-22(28)19-9-1-2-10-20(19)23(26)29/h1-12H,13-14H2,(H,25,27) |
| InChIKey | AXFJEPDKNBQXCV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|