C14H20N4O3S2 — CID 56507226
3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropane-1-sulfonamide (PubChem CID 56507226) has the molecular formula C14H20N4O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 56507226 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropane-1-sulfonamide |
| SMILES | COc1ccccc1-n1cnnc1SCCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H20N4O3S2/c1-17(2)23(19,20)10-6-9-22-14-16-15-11-18(14)12-7-4-5-8-13(12)21-3/h4-5,7-8,11H,6,9-10H2,1-3H3 |
| InChIKey | FDAFTDXSAGWEQW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|