C22H22N2O4S2 — CID 56507361
3-O-[4-(1,3-dithiolan-2-yl)phenyl] 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-3,5-dicarboxylate (PubChem CID 56507361) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-O-[4-(1,3-dithiolan-2-yl)phenyl] 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-3,5-dicarboxylate.
| Compound Name | 3-O-[4-(1,3-dithiolan-2-yl)phenyl] 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 56507361 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-O-[4-(1,3-dithiolan-2-yl)phenyl] 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C(C(=O)Oc2ccc(C3SCCS3)cc2)C1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-2-27-20(25)18-14-19(24(23-18)16-6-4-3-5-7-16)21(26)28-17-10-8-15(9-11-17)22-29-12-13-30-22/h3-11,19,22H,2,12-14H2,1H3 |
| InChIKey | SXUCSNAAUHQJGD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|