C25H18FN3O4 — CID 56507833
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 56507833) has the molecular formula C25H18FN3O4 and a molecular weight of 443.43 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 56507833 |
| Molecular Formula | C25H18FN3O4 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C25H18FN3O4/c26-20-10-3-4-11-21(20)28-14-15(12-22(28)30)23(31)27-16-6-5-7-17(13-16)29-24(32)18-8-1-2-9-19(18)25(29)33/h1-11,13,15H,12,14H2,(H,27,31) |
| InChIKey | QNSPEUWSZSOSKU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|