C19H30N2O2 — CID 56508711
2-(4-tert-butylphenoxy)-N-methyl-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 56508711) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-methyl-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-methyl-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 56508711 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-methyl-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | CN(CCN1CCCC1)C(=O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2/c1-19(2,3)16-7-9-17(10-8-16)23-15-18(22)20(4)13-14-21-11-5-6-12-21/h7-10H,5-6,11-15H2,1-4H3 |
| InChIKey | RXUPHYWOQZSUGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |