C20H23BrN4O2 — CID 56508882
3-bromo-N-[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]adamantane-1-carboxamide (PubChem CID 56508882) has the molecular formula C20H23BrN4O2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 3-bromo-N-[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 56508882 |
| Molecular Formula | C20H23BrN4O2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-bromo-N-[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]adamantane-1-carboxamide |
| SMILES | COc1ccccc1-c1nc(NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)n[nH]1 |
| InChI | InChI=1S/C20H23BrN4O2/c1-27-15-5-3-2-4-14(15)16-22-18(25-24-16)23-17(26)19-7-12-6-13(8-19)10-20(21,9-12)11-19/h2-5,12-13H,6-11H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | VCNVFZPESQAUHU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|