C24H25N5O2 — CID 56509929
2,5-dimethyl-N-[2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]-1-phenylpyrrole-3-carboxamide (PubChem CID 56509929) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]-1-phenylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56509929 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2,5-dimethyl-N-[2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(c2nc(-c3cccnc3)no2)C(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H25N5O2/c1-15(2)21(24-27-22(28-31-24)18-9-8-12-25-14-18)26-23(30)20-13-16(3)29(17(20)4)19-10-6-5-7-11-19/h5-15,21H,1-4H3,(H,26,30) |
| InChIKey | CGHSFPJJUBLIOE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|