C21H29F3N4O3S — CID 56509966
N-methyl-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]propanamide (PubChem CID 56509966) has the molecular formula C21H29F3N4O3S and a molecular weight of 474.55 g/mol. Its IUPAC name is N-methyl-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]propanamide.
| Compound Name | N-methyl-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 56509966 |
| Molecular Formula | C21H29F3N4O3S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-methyl-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]propanamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCC(=O)N(C)Cc2nccn2CC(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C21H29F3N4O3S/c1-13-14(2)16(4)20(17(5)15(13)3)32(30,31)26-8-7-19(29)27(6)11-18-25-9-10-28(18)12-21(22,23)24/h9-10,26H,7-8,11-12H2,1-6H3 |
| InChIKey | MZWHRHSUQHNUAH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |