C17H18Cl2F3N3O2 — CID 56510109
4-(2,3-dichlorophenoxy)-N-methyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]butanamide (PubChem CID 56510109) has the molecular formula C17H18Cl2F3N3O2 and a molecular weight of 424.25 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-N-methyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]butanamide.
| Compound Name | 4-(2,3-dichlorophenoxy)-N-methyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 56510109 |
| Molecular Formula | C17H18Cl2F3N3O2 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-N-methyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]butanamide |
| SMILES | CN(Cc1nccn1CC(F)(F)F)C(=O)CCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl2F3N3O2/c1-24(10-14-23-7-8-25(14)11-17(20,21)22)15(26)6-3-9-27-13-5-2-4-12(18)16(13)19/h2,4-5,7-8H,3,6,9-11H2,1H3 |
| InChIKey | VVMKZJPJKDBXSQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|