C22H30N2O3S — CID 56510289
phenyl 2-[4-[[benzyl(methyl)amino]methyl]piperidin-1-yl]ethanesulfonate (PubChem CID 56510289) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is phenyl 2-[4-[[benzyl(methyl)amino]methyl]piperidin-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[4-[[benzyl(methyl)amino]methyl]piperidin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 56510289 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | phenyl 2-[4-[[benzyl(methyl)amino]methyl]piperidin-1-yl]ethanesulfonate |
| SMILES | CN(Cc1ccccc1)CC1CCN(CCS(=O)(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N2O3S/c1-23(18-20-8-4-2-5-9-20)19-21-12-14-24(15-13-21)16-17-28(25,26)27-22-10-6-3-7-11-22/h2-11,21H,12-19H2,1H3 |
| InChIKey | VARMOFGYXPOTIV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|