About 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide
2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide (PubChem CID 56513116) has the molecular formula C18H18BrN3O3S2
and a molecular weight of 468.40 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide |
| PubChem CID | 56513116 |
| Molecular Formula | C18H18BrN3O3S2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide |
| SMILES | COCCN(Cc1cccnc1)S(=O)(=O)c1csc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C18H18BrN3O3S2/c1-25-10-9-22(12-14-3-2-8-20-11-14)27(23,24)17-13-26-18(21-17)15-4-6-16(19)7-5-15/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | IDJXQOQURNIWNL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide?
The IUPAC name of 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide (CID 56513116) is 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide.
What is the SMILES notation for 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide?
The canonical SMILES for 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide is COCCN(Cc1cccnc1)S(=O)(=O)c1csc(-c2ccc(Br)cc2)n1.
What is the InChIKey of 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide?
The InChIKey is IDJXQOQURNIWNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrN3O3S2/c1-25-10-9-22(12-14-3-2-8-20-11-14)27(23,24)17-13-26-18(21-17)15-4-6-16(19)7-5-15/h2-8,11,13H,9-10,12H2,1H3.
What are the key properties of 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide?
2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide has a molecular weight of 468.40 g/mol, XLogP of 3.80, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-N-(2-methoxyethyl)-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-sulfonamide is sourced from PubChem (CID 56513116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).