About N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide
N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide (PubChem CID 56513679) has the molecular formula C23H22N4O3
and a molecular weight of 402.45 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide.
Molecular Properties
| Compound Name | N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide |
| PubChem CID | 56513679 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)Nc1ccc2oc(C3CC3)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C23H22N4O3/c24-13-4-14-27(18-5-2-1-3-6-18)22(29)12-11-21(28)25-17-9-10-20-19(15-17)26-23(30-20)16-7-8-16/h1-3,5-6,9-10,15-16H,4,7-8,11-12,14H2,(H,25,28) |
| InChIKey | GSYXYAAUHRZDGQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide?
The IUPAC name of N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide (CID 56513679) is N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide.
What is the SMILES notation for N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide?
The canonical SMILES for N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide is N#CCCN(C(=O)CCC(=O)Nc1ccc2oc(C3CC3)nc2c1)c1ccccc1.
What is the InChIKey of N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide?
The InChIKey is GSYXYAAUHRZDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3/c24-13-4-14-27(18-5-2-1-3-6-18)22(29)12-11-21(28)25-17-9-10-20-19(15-17)26-23(30-20)16-7-8-16/h1-3,5-6,9-10,15-16H,4,7-8,11-12,14H2,(H,25,28).
What are the key properties of N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide?
N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide has a molecular weight of 402.45 g/mol, XLogP of 4.37, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanoethyl)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N'-phenylbutanediamide is sourced from PubChem (CID 56513679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).