C20H23F3N4O3S — CID 56513839
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 56513839) has the molecular formula C20H23F3N4O3S and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 56513839 |
| Molecular Formula | C20H23F3N4O3S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(NCCNc1ncccc1C(F)(F)F)C(c1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C20H23F3N4O3S/c21-20(22,23)16-7-4-8-24-18(16)25-9-10-26-19(28)17(15-5-2-1-3-6-15)27-11-13-31(29,30)14-12-27/h1-8,17H,9-14H2,(H,24,25)(H,26,28) |
| InChIKey | FEZIFCUKEKYWFN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|