About 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide
3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide (PubChem CID 56513916) has the molecular formula C15H16Cl2N2O4S2
and a molecular weight of 423.34 g/mol. Its IUPAC name is 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide |
| PubChem CID | 56513916 |
| Molecular Formula | C15H16Cl2N2O4S2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H16Cl2N2O4S2/c1-10(12-3-2-4-13(8-12)25(18,22)23)19-24(20,21)9-11-5-6-14(16)15(17)7-11/h2-8,10,19H,9H2,1H3,(H2,18,22,23) |
| InChIKey | WMKMJUMBNUDDKS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide?
The IUPAC name of 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide (CID 56513916) is 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide.
What is the SMILES notation for 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide?
The canonical SMILES for 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide is CC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1cccc(S(N)(=O)=O)c1.
What is the InChIKey of 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide?
The InChIKey is WMKMJUMBNUDDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O4S2/c1-10(12-3-2-4-13(8-12)25(18,22)23)19-24(20,21)9-11-5-6-14(16)15(17)7-11/h2-8,10,19H,9H2,1H3,(H2,18,22,23).
What are the key properties of 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide?
3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide has a molecular weight of 423.34 g/mol, XLogP of 2.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(3,4-dichlorophenyl)methylsulfonylamino]ethyl]benzenesulfonamide is sourced from PubChem (CID 56513916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).