About [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol
[5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol (PubChem CID 565145) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol |
| PubChem CID | 565145 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol |
| SMILES | CC12C=CC(CC1)C1(C2)OC(CO)C(CO)O1 |
| InChI | InChI=1S/C13H20O4/c1-12-4-2-9(3-5-12)13(8-12)16-10(6-14)11(7-15)17-13/h2,4,9-11,14-15H,3,5-8H2,1H3 |
| InChIKey | AYEHFFPBWXYZHS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol (CID 565145) is [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol is CC12C=CC(CC1)C1(C2)OC(CO)C(CO)O1.
What is the InChIKey of [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol?
The InChIKey is AYEHFFPBWXYZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-12-4-2-9(3-5-12)13(8-12)16-10(6-14)11(7-15)17-13/h2,4,9-11,14-15H,3,5-8H2,1H3.
What are the key properties of [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol?
[5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol has a molecular weight of 240.30 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-1'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene]-4-yl]methanol is sourced from PubChem (CID 565145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).