C25H35N5O2 — CID 56515304
3-[[benzyl(methyl)carbamoyl]amino]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide (PubChem CID 56515304) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 56515304 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCNC(=O)N(C)Cc3ccccc3)c(C)c2)CC1 |
| InChI | InChI=1S/C25H35N5O2/c1-4-29-14-16-30(17-15-29)22-10-11-23(20(2)18-22)27-24(31)12-13-26-25(32)28(3)19-21-8-6-5-7-9-21/h5-11,18H,4,12-17,19H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | NRGMZNIUIODKSJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|