C17H17ClN4O5S — CID 56516304
N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]-4-(methanesulfonamido)phenyl]acetamide (PubChem CID 56516304) has the molecular formula C17H17ClN4O5S and a molecular weight of 424.87 g/mol. Its IUPAC name is N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]-4-(methanesulfonamido)phenyl]acetamide.
| Compound Name | N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]-4-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 56516304 |
| Molecular Formula | C17H17ClN4O5S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]-4-(methanesulfonamido)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NS(C)(=O)=O)c(C(=O)NNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H17ClN4O5S/c1-10(23)19-13-7-8-15(22-28(2,26)27)14(9-13)17(25)21-20-16(24)11-3-5-12(18)6-4-11/h3-9,22H,1-2H3,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | ZSZAWPNXLSENTI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|