C16H17ClFN3O5S — CID 56517370
2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 56517370) has the molecular formula C16H17ClFN3O5S and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 56517370 |
| Molecular Formula | C16H17ClFN3O5S |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC1(c2ccc(F)cc2Cl)NC(=O)N(CC(=O)NC2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C16H17ClFN3O5S/c1-16(11-3-2-9(18)6-12(11)17)14(23)21(15(24)20-16)7-13(22)19-10-4-5-27(25,26)8-10/h2-3,6,10H,4-5,7-8H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | VRKBWKCFMHJTGL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|